| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:06:47 UTC |
|---|
| Update Date | 2025-03-21 18:29:37 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00078496 |
|---|
| Frequency | 37.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C4H7O8P |
|---|
| Molecular Mass | 213.9879 |
|---|
| SMILES | O=C(O)C(=O)C(CO)OP(=O)(O)O |
|---|
| InChI Key | RTFTXFCXFWMQRI-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbonyl compounds |
|---|
| Direct Parent | glycerone phosphates |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alpha-hydroxy ketonesalpha-keto acids and derivativesbeta-hydroxy ketonescarboxylic acidshydrocarbon derivativesmonoalkyl phosphatesmonocarboxylic acids and derivativesorganic oxidesprimary alcoholsshort-chain keto acids and derivatives |
|---|
| Substituents | alcoholbeta-hydroxy ketonealiphatic acyclic compoundcarboxylic acidshort-chain keto acidalpha-hydroxy ketonecarboxylic acid derivativeglycerone phosphateorganic oxidemonocarboxylic acid or derivativesphosphoric acid estermonoalkyl phosphateketo acidalpha-keto acidhydrocarbon derivativeprimary alcoholorganic phosphoric acid derivativealkyl phosphate |
|---|
