| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-21 00:06:50 UTC |
|---|
| Update Date | 2025-03-21 18:29:38 UTC |
|---|
| HMDB ID | HMDB0012848 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00078588 |
|---|
| Name | 7'-Carboxy-alpha-chromanol |
|---|
| Frequency | 37.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C21H32O4 |
|---|
| Molecular Mass | 348.2301 |
|---|
| SMILES | Cc1c(C)c2c(c(C)c1O)CCC(C)(CCCC(C)CCC(=O)O)O2 |
|---|
| InChI Key | RXYXCDMLSTZSRY-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | benzopyrans |
|---|
| Subclass | 1-benzopyrans |
|---|
| Direct Parent | 1-benzopyrans |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersbenzenoidscarbonyl compoundscarboxylic acidsheterocyclic fatty acidshydrocarbon derivativeshydroxy fatty acidsmedium-chain fatty acidsmedium-chain hydroxy acids and derivativesmethyl-branched fatty acidsmonocarboxylic acids and derivativesorganic oxidesoxacyclic compounds |
|---|
| Substituents | fatty acylcarbonyl groupethercarboxylic acid1-benzopyranheterocyclic fatty acidfatty acidalkyl aryl ethercarboxylic acid derivativemedium-chain hydroxy acidorganic oxidearomatic heteropolycyclic compoundmedium-chain fatty acidhydroxy fatty acidmethyl-branched fatty acidbranched fatty acidoxacyclemonocarboxylic acid or derivativesorganic oxygen compoundhydrocarbon derivativebenzenoidorganooxygen compound |
|---|