| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:06:55 UTC |
|---|
| Update Date | 2025-03-21 18:29:39 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00078802 |
|---|
| Frequency | 37.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H19NO8 |
|---|
| Molecular Mass | 293.1111 |
|---|
| SMILES | CC(=O)NC1C(O)CC(O)(C=O)OC1C(O)C(O)CO |
|---|
| InChI Key | RXDOKMZSQPQVPD-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pyrans |
|---|
| Subclass | pyran carboxylic acids and derivatives |
|---|
| Direct Parent | pyran carboxylic acids |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetamidesaldehydescarboxylic acids and derivativeshemiacetalshydrocarbon derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanesprimary alcoholspyranssecondary alcoholssecondary carboxylic acid amides |
|---|
| Substituents | alcoholcarbonyl grouppyran carboxylic acid or derivativesaldehydecarboxamide groupcarboxylic acid derivativeoxacyclesecondary carboxylic acid amideorganic oxideorganic oxygen compoundaliphatic heteromonocyclic compoundorganonitrogen compoundsecondary alcoholorganopnictogen compoundhemiacetalhydrocarbon derivativeorganic nitrogen compoundoxaneprimary alcoholacetamideorganooxygen compound |
|---|
