| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:06:56 UTC |
|---|
| Update Date | 2025-03-21 18:29:40 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00078859 |
|---|
| Frequency | 37.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H17N4O2S+ |
|---|
| Molecular Mass | 281.1067 |
|---|
| SMILES | Cc1c(CCO)sc[n+]1Cc1cn(C)c(=O)nc1N |
|---|
| InChI Key | ORZWOHJTXKEXQB-UHFFFAOYSA-O |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | diazines |
|---|
| Subclass | pyrimidines and pyrimidine derivatives |
|---|
| Direct Parent | thiamines |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 4,5-disubstituted thiazolesalcohols and polyolsazacyclic compoundsheteroaromatic compoundshydrocarbon derivativesimidolactamsorganic carbonic acids and derivativesorganic cationsorganic oxidesorganopnictogen compoundsprimary aminespyrimidones |
|---|
| Substituents | alcoholcarbonic acid derivativearomatic heteromonocyclic compoundazacycleheteroaromatic compoundpyrimidone4,5-disubstituted 1,3-thiazoleorganic oxideorganic oxygen compoundthiamineorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeprimary amineorganic nitrogen compoundorganic cationimidolactamthiazoleamineorganooxygen compoundazole |
|---|
