| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:06:57 UTC |
|---|
| Update Date | 2025-03-21 18:29:40 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00078883 |
|---|
| Frequency | 37.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H13N5O4 |
|---|
| Molecular Mass | 267.0968 |
|---|
| SMILES | Nc1ncnc2c1ncn2C1OC(CO)C(CO)O1 |
|---|
| InChI Key | XHWIYYMRPBLNNB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | imidazopyrimidines |
|---|
| Subclass | purines and purine derivatives |
|---|
| Direct Parent | purines and purine derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1,3-dioxolanesazacyclic compoundsheteroaromatic compoundshydrocarbon derivativesimidazolesimidolactamsn-substituted imidazolesorganopnictogen compoundsoxacyclic compoundsprimary alcoholsprimary aminespyrimidines and pyrimidine derivatives |
|---|
| Substituents | alcoholmeta-dioxolaneazacycleheteroaromatic compoundpyrimidineoxacycleorganic oxygen compoundaromatic heteropolycyclic compoundimidazoleorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeprimary aminepurineorganic nitrogen compoundprimary alcoholimidolactamamineorganooxygen compoundazolen-substituted imidazole |
|---|
