| Record Information |
|---|
| HMDB Status | quantified |
|---|
| Creation Date | 2024-02-21 00:07:01 UTC |
|---|
| Update Date | 2025-03-21 18:29:42 UTC |
|---|
| HMDB ID | HMDB0002089 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00079044 |
|---|
| Name | N-Ribosylhistidine |
|---|
| Frequency | 37.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H17N3O6 |
|---|
| Molecular Mass | 287.1117 |
|---|
| SMILES | NC(Cc1cn(C2OC(CO)C(O)C2O)cn1)C(=O)O |
|---|
| InChI Key | TTYCFBAOLXCFAB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | nucleosides, nucleotides, and analogues |
|---|
| Class | imidazole ribonucleosides and ribonucleotides |
|---|
| Subclass | imidazole ribonucleosides and ribonucleotides |
|---|
| Direct Parent | imidazole ribonucleosides and ribonucleotides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | alpha amino acidsazacyclic compoundscarbonyl compoundscarboxylic acidsheteroaromatic compoundshydrocarbon derivativesimidazolesmonoalkylaminesmonocarboxylic acids and derivativesmonosaccharidesn-substituted imidazolesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsprimary alcoholssecondary alcoholstetrahydrofurans |
|---|
| Substituents | imidazole ribonucleosidecarbonyl groupcarboxylic acidaromatic heteromonocyclic compoundmonosaccharidealpha-amino acid or derivativescarboxylic acid derivativesaccharideorganic oxideimidazoleorganonitrogen compoundalpha-amino acidorganopnictogen compoundprimary alcoholorganoheterocyclic compoundazolen-substituted imidazolealcoholazacycletetrahydrofuranheteroaromatic compoundoxacyclemonocarboxylic acid or derivativesorganic oxygen compoundsecondary alcoholhydrocarbon derivativeprimary aliphatic amineorganic nitrogen compoundorganooxygen compound |
|---|