| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:07:02 UTC |
|---|
| Update Date | 2025-03-21 18:29:42 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00079101 |
|---|
| Frequency | 36.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H6O6S |
|---|
| Molecular Mass | 217.9885 |
|---|
| SMILES | O=Cc1cc(OS(=O)(=O)O)ccc1O |
|---|
| InChI Key | SLWMJXZISJKONR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic sulfuric acids and derivatives |
|---|
| Subclass | arylsulfates |
|---|
| Direct Parent | phenylsulfates |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsbenzoyl derivativeshydrocarbon derivativeshydroxybenzaldehydesorganic oxidesorganooxygen compoundsphenoxy compoundssulfuric acid monoestersvinylogous acids |
|---|
| Substituents | monocyclic benzene moietysulfuric acid monoesterbenzoyl1-hydroxy-2-unsubstituted benzenoidaldehydearomatic homomonocyclic compoundphenylsulfatevinylogous acidbenzaldehydeorganic oxidearyl-aldehydeorganic oxygen compoundsulfate-esterphenolhydrocarbon derivativebenzenoidphenoxy compoundsulfuric acid esterhydroxybenzaldehydeorganooxygen compound |
|---|
