| Record Information |
|---|
| HMDB Status | predicted |
|---|
| Creation Date | 2024-02-21 00:07:04 UTC |
|---|
| Update Date | 2025-03-21 18:29:43 UTC |
|---|
| HMDB ID | HMDB0130499 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00079169 |
|---|
| Name | 3-(4-hydroxyphenyl)-3,4-dihydro-2H-1-benzopyran-4,6,7-triol |
|---|
| Frequency | 36.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H14O5 |
|---|
| Molecular Mass | 274.0841 |
|---|
| SMILES | Oc1ccc(C2COc3cc(O)c(O)cc3C2O)cc1 |
|---|
| InChI Key | MNVIHMBSEWTNDY-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | isoflavonoids |
|---|
| Subclass | isoflavans |
|---|
| Direct Parent | isoflavanols |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-benzopyrans1-hydroxy-2-unsubstituted benzenoidsalkyl aryl ethersbenzene and substituted derivativeshydrocarbon derivativesoxacyclic compoundssecondary alcohols |
|---|
| Substituents | alcoholmonocyclic benzene moietyetherbenzopyran1-benzopyranisoflavanol1-hydroxy-2-unsubstituted benzenoidalkyl aryl etheroxacycleorganic oxygen compoundaromatic heteropolycyclic compoundsecondary alcoholchromanephenolhydrocarbon derivativebenzenoidorganoheterocyclic compoundorganooxygen compound |
|---|
