| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:07:04 UTC |
|---|
| Update Date | 2025-03-21 18:29:43 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00079171 |
|---|
| Frequency | 36.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H15N5O5 |
|---|
| Molecular Mass | 309.1073 |
|---|
| SMILES | Nc1ncnc2c1ncn2C1OC(CO)C2OC(CO)OC21 |
|---|
| InChI Key | ZRPJRMHBIZCGAC-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | nucleosides, nucleotides, and analogues |
|---|
| Class | purine nucleosides |
|---|
| Subclass | purine nucleosides |
|---|
| Direct Parent | purine nucleosides |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1,3-dioxolanesacetalsazacyclic compoundsheteroaromatic compoundshydrocarbon derivativesimidazolesimidolactamsn-substituted imidazolesorganopnictogen compoundsoxacyclic compoundsprimary alcoholsprimary aminespurines and purine derivativespyrimidines and pyrimidine derivativestetrahydrofurans |
|---|
| Substituents | meta-dioxolaneimidazopyrimidinepyrimidineacetalaromatic heteropolycyclic compoundimidazoleorganonitrogen compoundorganopnictogen compoundprimary alcoholimidolactamorganoheterocyclic compoundazolen-substituted imidazolealcoholazacycletetrahydrofuranpurine nucleosideheteroaromatic compoundoxacycleorganic oxygen compoundhydrocarbon derivativeprimary aminepurineorganic nitrogen compoundamineorganooxygen compound |
|---|
