| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:07:06 UTC |
|---|
| Update Date | 2025-03-21 18:29:45 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00079262 |
|---|
| Frequency | 36.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H20NO5+ |
|---|
| Molecular Mass | 222.1336 |
|---|
| SMILES | C[N+](C)(C)C1C(O)C(O)C(O)C(O)C1O |
|---|
| InChI Key | OTHNVGVLSHOZFB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | alcohols and polyols |
|---|
| Direct Parent | aminocyclitols and derivatives |
|---|
| Geometric Descriptor | aliphatic homomonocyclic compounds |
|---|
| Alternative Parents | 1,2-aminoalcoholsaminescyclohexanolscyclohexylamineshydrocarbon derivativesorganic cationsorganic saltsorganopnictogen compoundstetraalkylammonium salts |
|---|
| Substituents | aminocyclitol or derivativestetraalkylammonium salt1,2-aminoalcoholquaternary ammonium saltcyclohexanolcyclohexylamineorganonitrogen compoundsecondary alcoholaliphatic homomonocyclic compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundorganic cationorganic saltamine |
|---|
