| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:07:12 UTC |
|---|
| Update Date | 2025-03-21 18:29:47 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00079499 |
|---|
| Frequency | 36.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H8O4S |
|---|
| Molecular Mass | 224.0143 |
|---|
| SMILES | O=S(O)c1cc(O)c2cc(O)ccc2c1 |
|---|
| InChI Key | NPTUKDBQBMMMOO-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | naphthalenes |
|---|
| Subclass | naphthols and derivatives |
|---|
| Direct Parent | naphthols and derivatives |
|---|
| Geometric Descriptor | aromatic homopolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidshydrocarbon derivativesorganic oxidesorganooxygen compoundsorganosulfur compoundssulfinic acids |
|---|
| Substituents | sulfinic acid derivative1-hydroxy-2-unsubstituted benzenoidaromatic homopolycyclic compound1-hydroxy-4-unsubstituted benzenoidorganosulfur compoundsulfinic acidorganic oxideorganic oxygen compoundhydrocarbon derivative1-naphthol2-naphtholorganooxygen compound |
|---|