| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:07:13 UTC |
|---|
| Update Date | 2025-03-21 18:29:47 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00079515 |
|---|
| Frequency | 36.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H7ClO4S |
|---|
| Molecular Mass | 233.9754 |
|---|
| SMILES | CS(=O)(=O)c1cc(C(=O)O)ccc1Cl |
|---|
| InChI Key | ZWBQTUAUWSDCKX-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzoic acids and derivatives |
|---|
| Direct Parent | halobenzoic acids |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 4-halobenzoic acidsaryl chloridesbenzenesulfonyl compoundsbenzoic acidsbenzoyl derivativescarboxylic acidschlorobenzeneshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganochloridesorganooxygen compoundssulfones |
|---|
| Substituents | carboxylic acidorganochloridebenzoylorganosulfur compoundcarboxylic acid derivativeorganohalogen compoundorganic oxidebenzoic acidbenzenesulfonyl grouparyl chloridechlorobenzenehalobenzoic acid4-halobenzoic acidaryl halide4-halobenzoic acid or derivativesaromatic homomonocyclic compoundmonocarboxylic acid or derivativessulfonylorganic oxygen compoundhydrocarbon derivativehalobenzeneorganooxygen compoundsulfone |
|---|
