| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:07:13 UTC |
|---|
| Update Date | 2025-03-21 18:29:47 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00079516 |
|---|
| Frequency | 36.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H19NO2 |
|---|
| Molecular Mass | 269.1416 |
|---|
| SMILES | CC(=O)NC(Cc1ccccc1)C(O)c1ccccc1 |
|---|
| InChI Key | JEYNHUOBNKRZFH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | linear 1,3-diarylpropanoids |
|---|
| Subclass | linear 1,3-diarylpropanoids |
|---|
| Direct Parent | linear 1,3-diarylpropanoids |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | acetamidesamphetamines and derivativesaromatic alcoholsbenzene and substituted derivativescarbonyl compoundscarboxylic acids and derivativeshydrocarbon derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundssecondary alcoholssecondary carboxylic acid amides |
|---|
| Substituents | aromatic alcoholalcohollinear 1,3-diarylpropanoidmonocyclic benzene moietycarbonyl groupcarboxamide groupcarboxylic acid derivativearomatic homomonocyclic compoundsecondary carboxylic acid amideorganic oxideorganic oxygen compoundorganonitrogen compoundsecondary alcoholorganopnictogen compoundhydrocarbon derivativebenzenoidorganic nitrogen compoundacetamideorganooxygen compoundamphetamine or derivatives |
|---|
