| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:07:16 UTC |
|---|
| Update Date | 2025-03-21 18:29:49 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00079650 |
|---|
| Frequency | 36.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H17NO4 |
|---|
| Molecular Mass | 203.1158 |
|---|
| SMILES | CC(C)CC(C(=O)O)N(C)CC(=O)O |
|---|
| InChI Key | VAMGJSSLPBQVGS-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | leucine and derivatives |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alpha amino acidsamino acidscarbonyl compoundscarboxylic acidsdicarboxylic acids and derivativeshydrocarbon derivativesmethyl-branched fatty acidsorganic oxidesorganopnictogen compoundstrialkylamines |
|---|
| Substituents | fatty acylaliphatic acyclic compoundcarbonyl groupcarboxylic acidamino acidfatty acidorganic oxideleucine or derivativesalpha-amino acidorganonitrogen compoundorganopnictogen compoundtertiary aminemethyl-branched fatty acidtertiary aliphatic aminebranched fatty acidorganic oxygen compounddicarboxylic acid or derivativeshydrocarbon derivativeorganic nitrogen compoundamineorganooxygen compound |
|---|
