| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:07:17 UTC |
|---|
| Update Date | 2025-03-21 18:29:49 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00079677 |
|---|
| Frequency | 44.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H7N5O2 |
|---|
| Molecular Mass | 205.06 |
|---|
| SMILES | Nc1nc2[nH]cc(CC=O)nc-2c(=O)n1 |
|---|
| InChI Key | TYMORAQQGLPCMV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pteridines and derivatives |
|---|
| Subclass | pterins and derivatives |
|---|
| Direct Parent | pterins and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | alpha-hydrogen aldehydesazacyclic compoundsheteroaromatic compoundshydrocarbon derivativesorganic oxidesorganopnictogen compoundsprimary aminespyrazinespyrimidones |
|---|
| Substituents | carbonyl grouppterinazacycleheteroaromatic compoundpyrimidonealdehydepyrimidineorganic oxideorganic oxygen compoundaromatic heteropolycyclic compoundalpha-hydrogen aldehydepyrazineorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeprimary amineorganic nitrogen compoundamineorganooxygen compound |
|---|
