| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:07:17 UTC |
|---|
| Update Date | 2025-03-21 18:29:49 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00079703 |
|---|
| Frequency | 36.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C22H26O10 |
|---|
| Molecular Mass | 450.1526 |
|---|
| SMILES | CC1C(O)C(O)C(O)C(O)C1Oc1cc(C2Oc3cc(O)cc(O)c3CC2O)ccc1O |
|---|
| InChI Key | SCVZBACQJBOBDV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | flavonoids |
|---|
| Subclass | flavans |
|---|
| Direct Parent | catechins |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-benzopyrans1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoids3-hydroxyflavonoids4'-hydroxyflavonoids5-hydroxyflavonoids7-hydroxyflavonoidsalkyl aryl etherscyclitols and derivativescyclohexanolshydrocarbon derivativesoxacyclic compoundsphenol ethersphenoxy compounds |
|---|
| Substituents | phenol ethermonocyclic benzene moiety3-hydroxyflavonoidether1-benzopyran1-hydroxy-2-unsubstituted benzenoidalkyl aryl etheraromatic heteropolycyclic compoundchromanecatechinorganoheterocyclic compoundalcoholbenzopyrancyclohexanol5-hydroxyflavonoidcyclitol or derivatives1-hydroxy-4-unsubstituted benzenoidcyclic alcoholoxacycleorganic oxygen compound7-hydroxyflavonoidsecondary alcohol4'-hydroxyflavonoidphenolhydrocarbon derivativebenzenoidphenoxy compoundorganooxygen compound |
|---|