| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:07:20 UTC |
|---|
| Update Date | 2025-03-21 18:29:51 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00079806 |
|---|
| Frequency | 36.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H9NO8 |
|---|
| Molecular Mass | 235.0328 |
|---|
| SMILES | O=C(O)CC(NC(C(=O)O)C(=O)O)C(=O)O |
|---|
| InChI Key | XTQIHCAQERRMMO-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | aspartic acid and derivatives |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | 1,3-dicarbonyl compoundsalpha amino acidsamino acidscarboxylic acidsdialkylamineshydrocarbon derivativesorganic oxidesorganopnictogen compoundstetracarboxylic acids and derivatives |
|---|
| Substituents | aliphatic acyclic compoundsecondary aliphatic aminecarbonyl groupcarboxylic acidamino acidtetracarboxylic acid or derivativessecondary amineorganic oxideorganic oxygen compoundaspartic acid or derivativesorganonitrogen compoundalpha-amino acidorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compound1,3-dicarbonyl compoundorganooxygen compoundamine |
|---|