| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-21 00:07:23 UTC |
|---|
| Update Date | 2025-03-21 18:29:52 UTC |
|---|
| HMDB ID | HMDB0002596 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00079935 |
|---|
| Name | Deoxycholic acid 3-glucuronide |
|---|
| Frequency | 36.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C30H48O10 |
|---|
| Molecular Mass | 568.3247 |
|---|
| SMILES | CC(CCC(=O)O)C1CCC2C3CCC4CC(OC5OC(C(=O)O)C(O)C(O)C5O)CCC4(C)C3CC(O)C12C |
|---|
| InChI Key | NNEIBJNHWVDJBA-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | steroids and steroid derivatives |
|---|
| Subclass | steroidal glycosides |
|---|
| Direct Parent | steroid glucuronide conjugates |
|---|
| Geometric Descriptor | aliphatic heteropolycyclic compounds |
|---|
| Alternative Parents | 12-hydroxysteroidsacetalsbeta hydroxy acids and derivativesbile acids, alcohols and derivativescarbonyl compoundscarboxylic acidscyclic alcohols and derivativesdicarboxylic acids and derivativesglucuronic acid derivativeshydrocarbon derivativesmonosaccharideso-glucuronidesorganic oxidesoxacyclic compoundsoxanespyran carboxylic acidssecondary alcohols |
|---|
| Substituents | carbonyl group12-hydroxysteroidcarboxylic acidglucuronic acid or derivativeso-glucuronidemonosaccharidecarboxylic acid derivativebile acid, alcohol, or derivativespyran carboxylic acid1-o-glucuronidealiphatic heteropolycyclic compoundbeta-hydroxy acidsaccharideorganic oxideacetaloxaneorganoheterocyclic compoundalcoholpyran carboxylic acid or derivativeshydroxysteroidhydroxy acidcyclic alcoholoxacycleorganic oxygen compoundpyransecondary alcoholdicarboxylic acid or derivativessteroid-glucuronide-skeletonhydrocarbon derivativeorganooxygen compound |
|---|