| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:07:34 UTC |
|---|
| Update Date | 2025-03-21 18:29:57 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00080376 |
|---|
| Frequency | 36.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H18N2O5 |
|---|
| Molecular Mass | 234.1216 |
|---|
| SMILES | CC(=O)NC1C(N)C(O)C(CO)C(O)C1O |
|---|
| InChI Key | OWTIJAMNJUGDRZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | alcohols and polyols |
|---|
| Direct Parent | cyclohexanols |
|---|
| Geometric Descriptor | aliphatic homomonocyclic compounds |
|---|
| Alternative Parents | acetamidescarbonyl compoundscarboxylic acids and derivativescyclitols and derivativeshydrocarbon derivativesmonoalkylaminesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsprimary alcoholssecondary carboxylic acid amides |
|---|
| Substituents | carbonyl groupcyclohexanolcyclitol or derivativescyclic alcoholcarboxamide groupcarboxylic acid derivativesecondary carboxylic acid amideorganic oxideorganonitrogen compoundaliphatic homomonocyclic compoundorganopnictogen compoundhydrocarbon derivativeprimary aliphatic amineorganic nitrogen compoundprimary alcoholacetamide |
|---|