| Record Information |
|---|
| HMDB Status | predicted |
|---|
| Creation Date | 2024-02-21 00:07:36 UTC |
|---|
| Update Date | 2025-03-21 18:29:58 UTC |
|---|
| HMDB ID | HMDB0128045 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00080451 |
|---|
| Name | 2-{[(2,4-dihydroxy-5-methoxyphenyl)(hydroxy)methylidene]amino}acetic acid |
|---|
| Frequency | 42.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H11NO6 |
|---|
| Molecular Mass | 241.0586 |
|---|
| SMILES | COc1cc(C(=O)NCC(=O)O)c(O)cc1O |
|---|
| InChI Key | AZFDKRSNEAHVSP-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | acyl glycines |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids4-alkoxyphenolsalkyl aryl ethersalpha amino acidsanisolesbenzoyl derivativescarbonyl compoundscarboxylic acidshippuric acids and derivativeshydrocarbon derivativesmethoxybenzenesmethoxyphenolsmonocarboxylic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsphenoxy compoundsresorcinolssalicylamidessecondary carboxylic acid amidesvinylogous acids |
|---|
| Substituents | phenol ethermonocyclic benzene moietycarbonyl groupethercarboxylic acidbenzoylmethoxyphenol1-hydroxy-2-unsubstituted benzenoidalkyl aryl etherbenzamideresorcinolorganic oxideorganonitrogen compoundalpha-amino acidorganopnictogen compound4-alkoxyphenolhippuric acid or derivativesbenzoic acid or derivativescarboxamide groupmethoxybenzenen-acylglycinesalicylamidearomatic homomonocyclic compoundsecondary carboxylic acid amidevinylogous acidmonocarboxylic acid or derivativesorganic oxygen compoundsalicylic acid or derivativesanisolephenolhydrocarbon derivativebenzenoidorganic nitrogen compoundphenoxy compoundorganooxygen compound |
|---|
