| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:07:37 UTC |
|---|
| Update Date | 2025-03-21 18:30:01 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00080521 |
|---|
| Frequency | 36.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H15N3O5S |
|---|
| Molecular Mass | 265.0732 |
|---|
| SMILES | NC(CO)C(=O)NC(CS)C(=O)NCC(=O)O |
|---|
| InChI Key | RNFKSBPHLTZHLU-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic polymers |
|---|
| Class | polypeptides |
|---|
| Subclass | polypeptides |
|---|
| Direct Parent | polypeptides |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | acyl glycinesalkylthiolsalpha amino acid amidesalpha amino acidscarbonyl compoundscarboxylic acidscysteine and derivativeshydrocarbon derivativesmonoalkylaminesmonocarboxylic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsorganosulfur compoundspeptidesprimary alcoholssecondary carboxylic acid amidesserine and derivatives |
|---|
| Substituents | aliphatic acyclic compoundcarbonyl groupcarboxylic acidalpha-amino acid or derivativesorganosulfur compoundcarboxylic acid derivativealpha peptideorganic oxideorganonitrogen compoundalpha-amino acidorganopnictogen compoundprimary alcoholn-acyl-alpha amino acid or derivativesalcoholpolypeptidealpha-amino acid amiden-acyl-alpha-amino acidcarboxamide groupn-acylglycinen-substituted-alpha-amino acidsecondary carboxylic acid amidemonocarboxylic acid or derivativesorganic oxygen compoundcysteine or derivativeshydrocarbon derivativeprimary aliphatic amineorganic nitrogen compoundserine or derivativesalkylthiolorganooxygen compound |
|---|