| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:07:40 UTC |
|---|
| Update Date | 2025-03-21 18:30:03 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00080617 |
|---|
| Frequency | 42.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H18N2O2 |
|---|
| Molecular Mass | 246.1368 |
|---|
| SMILES | O=C(NCCCN1CCCC1=O)c1ccccc1 |
|---|
| InChI Key | QCUKOSKYQVGDOS-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzoic acids and derivatives |
|---|
| Direct Parent | benzamides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsbenzoyl derivativescarbonyl compoundscarboxylic acids and derivativeshydrocarbon derivativeslactamsn-alkylpyrrolidinesorganic oxidesorganonitrogen compoundsorganopnictogen compoundspyrrolidine-2-onessecondary carboxylic acid amidestertiary carboxylic acid amides |
|---|
| Substituents | 2-pyrrolidonecarbonyl grouplactamaromatic heteromonocyclic compoundbenzoylcarboxylic acid derivativebenzamideorganic oxidetertiary carboxylic acid amideorganonitrogen compoundorganopnictogen compoundpyrrolidinepyrrolidoneorganoheterocyclic compoundazacyclen-alkylpyrrolidinecarboxamide groupsecondary carboxylic acid amideorganic oxygen compoundhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|
