| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:07:42 UTC |
|---|
| Update Date | 2025-03-21 18:30:04 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00080712 |
|---|
| Frequency | 36.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H20O5 |
|---|
| Molecular Mass | 256.1311 |
|---|
| SMILES | COCCc1ccc(OCC(O)C(O)CO)cc1 |
|---|
| InChI Key | BGJXUJZIIKNLGY-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | phenols |
|---|
| Subclass | tyrosols and derivatives |
|---|
| Direct Parent | tyrosols and derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersdialkyl ethershydrocarbon derivativesphenol ethersphenoxy compoundsprimary alcoholssecondary alcohols |
|---|
| Substituents | alcoholphenol ethermonocyclic benzene moietyetheralkyl aryl etherdialkyl etheraromatic homomonocyclic compoundorganic oxygen compoundsecondary alcoholhydrocarbon derivativetyrosol derivativephenoxy compoundprimary alcoholorganooxygen compound |
|---|
