| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:07:47 UTC |
|---|
| Update Date | 2025-03-21 18:30:06 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00080904 |
|---|
| Frequency | 35.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C21H31N5O8P+ |
|---|
| Molecular Mass | 512.1905 |
|---|
| SMILES | Cc1cc2nc3c(=O)[nH]c(=O)nc-3n(CC(O)C(O)COP(=O)(O)OCC[N+](C)(C)C)c2cc1C |
|---|
| InChI Key | CUBOBDQQAASZMY-UHFFFAOYSA-O |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pteridines and derivatives |
|---|
| Subclass | alloxazines and isoalloxazines |
|---|
| Direct Parent | flavins |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1,2-diolsaminesazacyclic compoundsbenzenoidsdialkyl phosphatesdiazanaphthalenesheteroaromatic compoundshydrocarbon derivativeslactamsorganic carbonic acids and derivativesorganic cationsorganic oxidesorganic saltsorganopnictogen compoundsphosphocholinespyrazinespyrimidonesquinoxalinessecondary alcoholstetraalkylammonium salts |
|---|
| Substituents | lactampyrimidoneflavinpyrimidineorganic oxidediazanaphthalenearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundorganic cationorganic salt1,2-diolalcoholquinoxalinecarbonic acid derivativetetraalkylammonium saltazacyclequaternary ammonium saltheteroaromatic compoundphosphocholinedialkyl phosphateorganic oxygen compoundphosphoric acid esterpyrazinesecondary alcoholhydrocarbon derivativebenzenoidorganic nitrogen compoundorganic phosphoric acid derivativeaminealkyl phosphateorganooxygen compound |
|---|
