| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:07:47 UTC |
|---|
| Update Date | 2025-03-21 18:30:06 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00080905 |
|---|
| Frequency | 35.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H8O6S |
|---|
| Molecular Mass | 268.0042 |
|---|
| SMILES | O=C(O)c1ccc2cccc(OS(=O)(=O)O)c2c1 |
|---|
| InChI Key | JQPXRNVBGVLNON-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | naphthalenes |
|---|
| Subclass | naphthalenecarboxylic acids and derivatives |
|---|
| Direct Parent | naphthalenecarboxylic acids |
|---|
| Geometric Descriptor | aromatic homopolycyclic compounds |
|---|
| Alternative Parents | arylsulfatescarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganooxygen compoundssulfuric acid monoesters |
|---|
| Substituents | sulfuric acid monoestercarboxylic acidorganic sulfuric acid or derivativesaromatic homopolycyclic compoundcarboxylic acid derivativeorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundsulfate-esterhydrocarbon derivativearylsulfate2-naphthalenecarboxylic acidsulfuric acid esterorganooxygen compound |
|---|