| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:07:48 UTC |
|---|
| Update Date | 2025-03-21 18:30:06 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00080936 |
|---|
| Frequency | 35.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H9Cl3O3 |
|---|
| Molecular Mass | 281.9617 |
|---|
| SMILES | O=C(O)COC(c1ccccc1)C(Cl)(Cl)Cl |
|---|
| InChI Key | LGKHOEXNMIFRGU-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzylethers |
|---|
| Direct Parent | benzylethers |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alkyl chloridescarbonyl compoundscarboxylic acidsdialkyl ethershydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganochlorides |
|---|
| Substituents | carbonyl groupethercarboxylic acidbenzyletheralkyl chlorideorganochloridecarboxylic acid derivativeorganohalogen compounddialkyl etheraromatic homomonocyclic compoundorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundalkyl halidehydrocarbon derivativeorganooxygen compound |
|---|
