| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:07:48 UTC |
|---|
| Update Date | 2025-03-21 18:30:07 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00080966 |
|---|
| Frequency | 35.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H14N2O5 |
|---|
| Molecular Mass | 242.0903 |
|---|
| SMILES | NC(Cc1ccc(CC(N)C(=O)O)o1)C(=O)O |
|---|
| InChI Key | HMEHBNRFRWBMHY-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | fatty acyls |
|---|
| Subclass | fatty acids and conjugates |
|---|
| Direct Parent | furanoid fatty acids |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | alpha amino acidscarbonyl compoundscarboxylic acidsdicarboxylic acids and derivativesfatty acylsfuransheteroaromatic compoundshydrocarbon derivativesmonoalkylaminesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compounds |
|---|
| Substituents | furancarbonyl groupcarboxylic acidaromatic heteromonocyclic compoundheteroaromatic compoundalpha-amino acid or derivativescarboxylic acid derivativeoxacycleorganic oxideorganic oxygen compoundorganonitrogen compoundalpha-amino aciddicarboxylic acid or derivativesorganopnictogen compoundhydrocarbon derivativeprimary aliphatic amineorganic nitrogen compoundorganoheterocyclic compoundorganooxygen compoundfuranoid fatty acid |
|---|
