| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:07:49 UTC |
|---|
| Update Date | 2025-03-21 18:30:07 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00081004 |
|---|
| Frequency | 35.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H26O5 |
|---|
| Molecular Mass | 310.178 |
|---|
| SMILES | CC1C(Oc2ccc(CCO)cc2)OC(C(O)O)C(C)C1C |
|---|
| InChI Key | AHKLZATVTIKYSG-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | phenols |
|---|
| Subclass | tyrosols and derivatives |
|---|
| Direct Parent | tyrosols and derivatives |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetalscarbonyl hydrateshydrocarbon derivativesoxacyclic compoundsoxanesphenol ethersphenoxy compounds |
|---|
| Substituents | alcoholphenol ethermonocyclic benzene moietycarbonyl hydratearomatic heteromonocyclic compoundoxacycleorganic oxygen compoundacetalhydrocarbon derivativetyrosol derivativephenoxy compoundoxaneorganoheterocyclic compoundorganooxygen compound |
|---|
