| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:07:50 UTC |
|---|
| Update Date | 2025-03-21 18:30:07 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00081027 |
|---|
| Frequency | 35.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H26O2 |
|---|
| Molecular Mass | 262.1933 |
|---|
| SMILES | CC(C)CCCC(C)c1ccc(C(C)C(=O)O)cc1 |
|---|
| InChI Key | BAJCFHULZHQBDO-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | prenol lipids |
|---|
| Subclass | sesquiterpenoids |
|---|
| Direct Parent | sesquiterpenoids |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | aromatic monoterpenoidsbenzene and substituted derivativescarbonyl compoundscarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesphenylpropanoic acids |
|---|
| Substituents | monocyclic benzene moietycarbonyl groupcarboxylic acidp-cymenecarboxylic acid derivativearomatic homomonocyclic compoundorganic oxidemonocarboxylic acid or derivativessesquiterpenoidorganic oxygen compound2-phenylpropanoic-acidhydrocarbon derivativebisabolane sesquiterpenoidbenzenoidorganooxygen compound |
|---|
