| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:07:51 UTC |
|---|
| Update Date | 2025-03-21 18:30:08 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00081081 |
|---|
| Frequency | 35.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H11O10P |
|---|
| Molecular Mass | 274.009 |
|---|
| SMILES | O=C(O)C(O)COP(=O)(O)OCC(O)C(=O)O |
|---|
| InChI Key | ADIDHPRYLPWDPA-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | sugar acids and derivatives |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alpha hydroxy acids and derivativescarbonyl compoundscarboxylic acidsdialkyl phosphatesdicarboxylic acids and derivativeshydrocarbon derivativesmonosaccharidesorganic oxidessecondary alcohols |
|---|
| Substituents | alcoholaliphatic acyclic compoundcarbonyl groupcarboxylic acidalpha-hydroxy acidmonosaccharidehydroxy acidcarboxylic acid derivativedialkyl phosphateorganic oxidephosphoric acid esterglyceric_acidsecondary alcoholdicarboxylic acid or derivativeshydrocarbon derivativeorganic phosphoric acid derivativealkyl phosphate |
|---|
