| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:07:54 UTC |
|---|
| Update Date | 2025-03-21 18:30:09 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00081184 |
|---|
| Frequency | 35.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C22H38NO3+ |
|---|
| Molecular Mass | 364.2846 |
|---|
| SMILES | C[N+](C)(C)CCOC(=O)CCCC=CCC=CCC=CCC=CCCO |
|---|
| InChI Key | YJAFSWRUMFYWLO-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic nitrogen compounds |
|---|
| Class | organonitrogen compounds |
|---|
| Subclass | quaternary ammonium salts |
|---|
| Direct Parent | acyl cholines |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alcohols and polyolsaminescarbonyl compoundscarboxylic acid estersfatty acid estershydrocarbon derivativesmonocarboxylic acids and derivativesorganic cationsorganic oxidesorganic saltsorganopnictogen compoundstetraalkylammonium salts |
|---|
| Substituents | alcoholfatty acylaliphatic acyclic compoundcarbonyl grouptetraalkylammonium saltcarboxylic acid derivativefatty acid esterorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundcarboxylic acid esteracyl cholineorganopnictogen compoundhydrocarbon derivativeorganic cationorganic saltamineorganooxygen compound |
|---|