| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:07:56 UTC |
|---|
| Update Date | 2025-03-21 18:30:10 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00081250 |
|---|
| Frequency | 35.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H16O2S |
|---|
| Molecular Mass | 212.0871 |
|---|
| SMILES | Cc1ccc(C)c(CS(C)(=O)=O)c1C |
|---|
| InChI Key | APBQJUBALHWAFW-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzene and substituted derivatives |
|---|
| Direct Parent | benzene and substituted derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | hydrocarbon derivativesorganic oxidessulfones |
|---|
| Substituents | aromatic homomonocyclic compoundmonocyclic benzene moietyorganic oxidesulfonylorganic oxygen compoundhydrocarbon derivativeorganosulfur compoundsulfone |
|---|
