| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:08:08 UTC |
|---|
| Update Date | 2025-03-21 18:30:17 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00081731 |
|---|
| Frequency | 62.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H14N6O2 |
|---|
| Molecular Mass | 238.1178 |
|---|
| SMILES | CC(O)C(O)C1=Nc2c(N)nc(N)nc2NC1 |
|---|
| InChI Key | VFYFXDQCOJVLOK-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pteridines and derivatives |
|---|
| Subclass | pteridines and derivatives |
|---|
| Direct Parent | pteridines and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1,2-diolsazacyclic compoundsheteroaromatic compoundshydrocarbon derivativesimidolactamsketiminesorganopnictogen compoundsprimary aminespropargyl-type 1,3-dipolar organic compoundspyrimidines and pyrimidine derivativessecondary alcoholssecondary alkylarylamines |
|---|
| Substituents | ketimineiminepteridinepyrimidinepropargyl-type 1,3-dipolar organic compoundaromatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundimidolactam1,2-diolalcoholazacycleheteroaromatic compoundorganic 1,3-dipolar compoundsecondary aminesecondary aliphatic/aromatic amineorganic oxygen compoundsecondary alcoholhydrocarbon derivativeprimary amineorganic nitrogen compoundamineorganooxygen compound |
|---|
