| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:08:09 UTC |
|---|
| Update Date | 2025-03-21 18:30:17 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00081749 |
|---|
| Frequency | 46.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H18N6O2 |
|---|
| Molecular Mass | 302.1491 |
|---|
| SMILES | CN1c2c(nc(N)[nH]c2=O)NCC1CNc1ccc(O)cc1 |
|---|
| InChI Key | DAVSCXKXSZDAFL-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pteridines and derivatives |
|---|
| Subclass | pterins and derivatives |
|---|
| Direct Parent | pterins and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsazacyclic compoundsbenzene and substituted derivativesdialkylarylaminesheteroaromatic compoundshydrocarbon derivativesimidolactamslactamsorganic oxidesorganooxygen compoundsorganopnictogen compoundsphenylalkylaminesprimary aminespyrimidonessecondary alkylarylaminesvinylogous amides |
|---|
| Substituents | monocyclic benzene moietylactam1-hydroxy-2-unsubstituted benzenoidpyrimidonepyrimidineorganic oxidearomatic heteropolycyclic compoundtertiary aliphatic/aromatic amineorganonitrogen compoundorganopnictogen compounddialkylarylamineimidolactamtertiary aminevinylogous amidepterinazacycleheteroaromatic compoundsecondary aminesecondary aliphatic/aromatic amineorganic oxygen compoundphenylalkylaminephenolhydrocarbon derivativebenzenoidprimary amineorganic nitrogen compoundamineorganooxygen compound |
|---|
