| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:08:10 UTC |
|---|
| Update Date | 2025-03-21 18:30:18 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00081781 |
|---|
| Frequency | 35.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H10NO5P |
|---|
| Molecular Mass | 231.0297 |
|---|
| SMILES | Cc1ncc(CP(=O)(O)O)c(C=O)c1O |
|---|
| InChI Key | MJHZPNZKADTPDP-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pyridines and derivatives |
|---|
| Subclass | pyridinecarboxylic acids and derivatives |
|---|
| Direct Parent | pyridinecarboxylic acids and derivatives |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 2-halopyridinesaryl-aldehydesazacyclic compoundsheteroaromatic compoundshydrocarbon derivativeshydroxypyridinesorganic oxidesorganic phosphonic acids and derivativesorganonitrogen compoundsorganooxygen compoundsorganophosphorus compoundsorganopnictogen compoundspolyhalopyridinespyridine carboxaldehydesvinylogous acids |
|---|
| Substituents | pyridine carboxylic acid or derivativesaromatic heteromonocyclic compoundazacyclepolyhalopyridineheteroaromatic compoundhydroxypyridinealdehyde4-pyridine carboxaldehydevinylogous acidorganic oxidearyl-aldehydeorganic oxygen compoundorganonitrogen compoundorganopnictogen compoundorganophosphorus compoundhydrocarbon derivative2-halopyridineorganic nitrogen compoundorganophosphonic acid derivativeorganooxygen compound |
|---|
