| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:08:10 UTC |
|---|
| Update Date | 2025-03-21 18:30:17 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00081793 |
|---|
| Frequency | 35.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H17NO13S2 |
|---|
| Molecular Mass | 411.0141 |
|---|
| SMILES | COC1OC(COS(=O)(=O)O)C(OC(C)=O)C(O)C1NOS(=O)(=O)O |
|---|
| InChI Key | LANDFXHUNIVWCF-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | monosaccharides |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetalsalkyl sulfatescarbonyl compoundscarboxylic acid estershydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanessecondary alcoholssulfuric acid monoesters |
|---|
| Substituents | sulfuric acid monoestercarbonyl groupmonosaccharidecarboxylic acid derivativeorganic oxideacetalalkyl sulfatealiphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compoundoxaneorganoheterocyclic compoundalcoholorganic sulfuric acid or derivativesoxacyclemonocarboxylic acid or derivativescarboxylic acid estersecondary alcoholsulfate-esterhydrocarbon derivativeorganic nitrogen compoundsulfuric acid ester |
|---|