| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:08:10 UTC |
|---|
| Update Date | 2025-03-21 18:30:17 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00081804 |
|---|
| Frequency | 35.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H10INO5 |
|---|
| Molecular Mass | 350.9604 |
|---|
| SMILES | NC(Cc1cc(I)c(O)c(C(=O)O)c1)C(=O)O |
|---|
| InChI Key | QIYFBOBYEOACBQ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | tyrosine and derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-carboxy-2-haloaromatic compounds3-halobenzoic acidsalpha amino acidsamphetamines and derivativesaryl iodidesbenzoic acidsbenzoyl derivativescarbonyl compoundsdicarboxylic acids and derivativeshalobenzoic acidshalophenolshydrocarbon derivativesiodobenzenesmonoalkylamineso-iodophenolsorganic oxidesorganoiodidesorganonitrogen compoundsorganopnictogen compoundsphenylalanine and derivativesphenylpropanoic acidssalicylic acidsvinylogous acids |
|---|
| Substituents | monocyclic benzene moietycarbonyl groupcarboxylic acid3-phenylpropanoic-acid3-halobenzoic acid or derivativesbenzoylsalicylic acidorganohalogen compoundiodobenzeneorganoiodideorganic oxide3-halobenzoic acidorganonitrogen compoundalpha-amino acidorganopnictogen compound1-carboxy-2-haloaromatic compoundbenzoic acidamphetamine or derivativeshalobenzoic acidtyrosine or derivatives2-iodophenolbenzoic acid or derivativeshalobenzoic acid or derivativesaryl halidehydroxybenzoic acidaromatic homomonocyclic compound2-halophenolvinylogous acidphenylalanine or derivativesorganic oxygen compoundsalicylic acid or derivativesdicarboxylic acid or derivativesphenolhydrocarbon derivativebenzenoidprimary aliphatic aminearyl iodideorganic nitrogen compoundhalobenzeneorganooxygen compound |
|---|