| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:08:12 UTC |
|---|
| Update Date | 2025-03-21 18:30:18 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00081855 |
|---|
| Frequency | 35.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H8INO5S |
|---|
| Molecular Mass | 356.9168 |
|---|
| SMILES | CC(=O)Nc1ccc(OS(=O)(=O)O)c(I)c1 |
|---|
| InChI Key | UDZDULSRJAAWPN-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | anilides |
|---|
| Direct Parent | m-haloacetanilides |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | acetamidesaryl iodidescarbonyl compoundscarboxylic acids and derivativeshydrocarbon derivativesiodobenzenesn-acetylarylaminesorganic oxidesorganoiodidesorganopnictogen compoundsphenoxy compoundsphenylsulfatessecondary carboxylic acid amidessulfuric acid monoesters |
|---|
| Substituents | sulfuric acid monoestercarbonyl groupn-acetylarylaminen-arylamidecarboxylic acid derivativeorganohalogen compoundiodobenzeneorganoiodidephenylsulfateorganic oxideorganonitrogen compoundorganopnictogen compoundarylsulfateacetamideorganic sulfuric acid or derivativescarboxamide grouparyl halidearomatic homomonocyclic compoundsecondary carboxylic acid amideorganic oxygen compoundsulfate-esterhydrocarbon derivativearyl iodideorganic nitrogen compoundhalobenzenephenoxy compoundsulfuric acid esterm-haloacetanilideorganooxygen compound |
|---|