| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:08:12 UTC |
|---|
| Update Date | 2025-03-21 18:30:19 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00081883 |
|---|
| Frequency | 35.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H14N2O2 |
|---|
| Molecular Mass | 266.1055 |
|---|
| SMILES | O=C(Cc1c[nH]c2ccccc12)Nc1ccccc1O |
|---|
| InChI Key | JXJZMAFGCQPYKE-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | indoles and derivatives |
|---|
| Subclass | indoles |
|---|
| Direct Parent | indoles |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsanilidesazacyclic compoundscarbonyl compoundscarboxylic acids and derivativesheteroaromatic compoundshydrocarbon derivativesn-arylamidesorganic oxidesorganopnictogen compoundspyrrolessecondary carboxylic acid amides |
|---|
| Substituents | monocyclic benzene moietycarbonyl groupindole1-hydroxy-2-unsubstituted benzenoidn-arylamidecarboxylic acid derivativeorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundazacycleheteroaromatic compound1-hydroxy-4-unsubstituted benzenoidcarboxamide groupanilidesecondary carboxylic acid amideorganic oxygen compoundpyrrolephenolhydrocarbon derivativebenzenoidorganic nitrogen compoundorganooxygen compound |
|---|
