| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:08:15 UTC |
|---|
| Update Date | 2025-03-21 18:30:20 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00082004 |
|---|
| Frequency | 35.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C3H6O8S |
|---|
| Molecular Mass | 201.9783 |
|---|
| SMILES | O=C(O)C(O)C(O)OS(=O)(=O)O |
|---|
| InChI Key | ZZCMJPZFPIQZQX-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | hydroxy acids and derivatives |
|---|
| Subclass | beta hydroxy acids and derivatives |
|---|
| Direct Parent | beta hydroxy acids and derivatives |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alkyl sulfatesalpha hydroxy acids and derivativescarbonyl compoundscarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidessecondary alcoholssulfuric acid monoesters |
|---|
| Substituents | alcoholaliphatic acyclic compoundsulfuric acid monoestercarbonyl groupcarboxylic acidorganic sulfuric acid or derivativesalpha-hydroxy acidmonosaccharidecarboxylic acid derivativebeta-hydroxy acidsaccharideorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundalkyl sulfatesecondary alcoholsulfate-esterhydrocarbon derivativesulfuric acid esterorganooxygen compound |
|---|