| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:08:20 UTC |
|---|
| Update Date | 2025-03-21 18:30:23 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00082189 |
|---|
| Frequency | 35.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H7N3O2 |
|---|
| Molecular Mass | 189.0538 |
|---|
| SMILES | O=C1NC(=O)C(=Cc2cccnc2)N1 |
|---|
| InChI Key | NDGOFGJAUMKSDQ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | azolidines |
|---|
| Subclass | imidazolidines |
|---|
| Direct Parent | hydantoins |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | alpha amino acidsazacyclic compoundscarbonyl compoundscarboxylic acids and derivativesdicarboximidesheteroaromatic compoundshydrocarbon derivativesimidazolidinonesorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundspyridines and derivatives |
|---|
| Substituents | carbonyl groupcarbonic acid derivativearomatic heteromonocyclic compoundazacycleheteroaromatic compoundalpha-amino acid or derivativescarboxylic acid derivativeorganic oxidepyridineorganic oxygen compoundhydantoinorganonitrogen compoundalpha-amino acidorganopnictogen compoundhydrocarbon derivativedicarboximideorganic nitrogen compoundorganooxygen compound |
|---|