| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:08:23 UTC |
|---|
| Update Date | 2025-03-21 18:30:28 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00082316 |
|---|
| Frequency | 35.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H13N4O6P |
|---|
| Molecular Mass | 316.0573 |
|---|
| SMILES | Cn1cnc2c1ncn2C1OC2COP(=O)(O)OC2C1O |
|---|
| InChI Key | AMZVVRMANUTEAU-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | pentose phosphates |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsheteroaromatic compoundshydrocarbon derivativesimidazolesmonosaccharidesn-substituted imidazolesorganic oxidesorganic phosphoric acids and derivativesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundssecondary alcoholstetrahydrofurans |
|---|
| Substituents | alcoholazacycletetrahydrofuranpentose phosphateheteroaromatic compoundoxacycleorganic oxidearomatic heteropolycyclic compoundimidazoleorganonitrogen compoundsecondary alcoholorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundorganic phosphoric acid derivativeorganoheterocyclic compoundazolen-substituted imidazole |
|---|