| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:08:24 UTC |
|---|
| Update Date | 2025-03-21 18:30:27 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00082339 |
|---|
| Frequency | 35.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H10N2O5S |
|---|
| Molecular Mass | 222.031 |
|---|
| SMILES | O=C(O)CNC(=O)NC(CS)C(=O)O |
|---|
| InChI Key | CBISVDUPQSFJIS-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | n-carbamoyl-alpha amino acids |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alkylthiolsalpha amino acidscarbonyl compoundscarboxylic acidscysteine and derivativesdicarboxylic acids and derivativeshydrocarbon derivativesorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsorganosulfur compounds |
|---|
| Substituents | aliphatic acyclic compoundcarbonyl groupcarbonic acid derivativecarboxylic acidn-carbamoyl-alpha-amino acidorganosulfur compoundorganic oxideorganic oxygen compoundcysteine or derivativesorganonitrogen compoundalpha-amino aciddicarboxylic acid or derivativesorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundalkylthiolorganooxygen compound |
|---|
