| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:08:27 UTC |
|---|
| Update Date | 2025-03-21 18:30:30 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00082470 |
|---|
| Frequency | 35.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H12N4O2 |
|---|
| Molecular Mass | 184.096 |
|---|
| SMILES | CN(C)c1c(N)[nH]c(=O)n(C)c1=O |
|---|
| InChI Key | QKFHGWAWTNYAED-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic nitrogen compounds |
|---|
| Class | organonitrogen compounds |
|---|
| Subclass | amines |
|---|
| Direct Parent | dialkylarylamines |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | aminopyrimidines and derivativesazacyclic compoundsheteroaromatic compoundshydrocarbon derivativeslactamsorganic carbonic acids and derivativesorganic oxidesorganooxygen compoundsorganopnictogen compoundsprimary aminespyrimidonesvinylogous amides |
|---|
| Substituents | vinylogous amidecarbonic acid derivativelactamaromatic heteromonocyclic compoundazacycleheteroaromatic compoundpyrimidonepyrimidineaminopyrimidineorganic oxideorganic oxygen compoundorganopnictogen compoundhydrocarbon derivativeprimary aminedialkylarylamineorganoheterocyclic compoundorganooxygen compound |
|---|
