| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:08:33 UTC |
|---|
| Update Date | 2025-03-21 18:30:33 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00082708 |
|---|
| Frequency | 34.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C20H18O7 |
|---|
| Molecular Mass | 370.1053 |
|---|
| SMILES | COc1cc(C=CC(=O)CC(=O)C=Cc2c(O)cc(O)cc2O)ccc1O |
|---|
| InChI Key | IOJROXIPQVDKMQ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | diarylheptanoids |
|---|
| Subclass | linear diarylheptanoids |
|---|
| Direct Parent | curcuminoids |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsacryloyl compoundsalkyl aryl ethersanisolesenoneshydrocarbon derivativeshydroxycinnamic acidsketonesmethoxybenzenesmethoxyphenolsorganic oxidesphenoxy compoundsphloroglucinols and derivatives |
|---|
| Substituents | phenol ethermonocyclic benzene moietycarbonyl groupether1-hydroxy-2-unsubstituted benzenoidmethoxyphenolalkyl aryl etheralpha,beta-unsaturated ketonehydroxycinnamic acid or derivativesketonephloroglucinol derivativecinnamic acid or derivativesorganic oxideenonedesmethoxycurcuminbenzenetriol1-hydroxy-4-unsubstituted benzenoidmethoxybenzenehydroxycinnamic acidaromatic homomonocyclic compoundorganic oxygen compoundanisolephenolhydrocarbon derivativebenzenoidacryloyl-groupphenoxy compoundorganooxygen compound |
|---|
