| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:08:34 UTC |
|---|
| Update Date | 2025-03-21 18:30:33 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00082727 |
|---|
| Frequency | 42.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H16N6O |
|---|
| Molecular Mass | 224.1386 |
|---|
| SMILES | CN(C)CC1CNc2[nH]c(N)nc(=O)c2N1 |
|---|
| InChI Key | TYWCIFZRVHOSCW-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pteridines and derivatives |
|---|
| Subclass | pterins and derivatives |
|---|
| Direct Parent | pterins and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsheteroaromatic compoundshydrocarbon derivativesorganic oxidesorganooxygen compoundsorganopnictogen compoundsprimary aminespyrimidonessecondary alkylarylaminestrialkylaminesvinylogous amides |
|---|
| Substituents | vinylogous amidepterinazacycleheteroaromatic compoundtertiary aliphatic aminepyrimidonesecondary aminesecondary aliphatic/aromatic aminepyrimidineorganic oxideorganic oxygen compoundaromatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeprimary amineorganic nitrogen compoundaminetertiary amineorganooxygen compound |
|---|