| Record Information |
|---|
| HMDB Status | predicted |
|---|
| Creation Date | 2024-02-21 00:08:46 UTC |
|---|
| Update Date | 2025-03-21 18:30:45 UTC |
|---|
| HMDB ID | HMDB0141087 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00083220 |
|---|
| Name | 1,7-bis(4-hydroxyphenyl)heptane-3,5-dione |
|---|
| Frequency | 34.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C19H20O4 |
|---|
| Molecular Mass | 312.1362 |
|---|
| SMILES | O=C(CCc1ccc(O)cc1)CC(=O)CCc1ccc(O)cc1 |
|---|
| InChI Key | KTRRXJQAOOYSDA-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | diarylheptanoids |
|---|
| Subclass | linear diarylheptanoids |
|---|
| Direct Parent | curcuminoids |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsbenzene and substituted derivativeshydrocarbon derivativesketonesorganic oxides |
|---|
| Substituents | monocyclic benzene moietycarbonyl groupdesmethoxycurcumin1-hydroxy-2-unsubstituted benzenoidketonearomatic homomonocyclic compoundorganic oxideorganic oxygen compoundphenolhydrocarbon derivativebenzenoidbis-desmethoxycurcuminorganooxygen compound |
|---|