| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:08:50 UTC |
|---|
| Update Date | 2025-03-21 18:30:51 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00083384 |
|---|
| Frequency | 34.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H9NO8 |
|---|
| Molecular Mass | 223.0328 |
|---|
| SMILES | O=NOC1OC(C(=O)O)C(O)C(O)C1O |
|---|
| InChI Key | ZQKUHLLVEIQMEW-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | glucuronic acid derivatives |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | alkyl nitritesbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharidesnitrite estersorganic o-nitroso compoundsorganic nitrogen compoundsorganic oxidesoxacyclic compoundsoxanespyran carboxylic acidssecondary alcohols |
|---|
| Substituents | carbonyl groupcarboxylic acidglucuronic acid or derivativesmonosaccharidecarboxylic acid derivativepyran carboxylic acidalkyl nitritebeta-hydroxy acidorganic oxidealiphatic heteromonocyclic compoundnitrite esteroxaneorganoheterocyclic compoundalcoholorganic nitroso compoundpyran carboxylic acid or derivativeshydroxy acidorganic nitriteoxacyclemonocarboxylic acid or derivativespyransecondary alcoholhydrocarbon derivativeorganic nitrogen compoundorganic o-nitroso compound |
|---|
