| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:08:51 UTC |
|---|
| Update Date | 2025-03-21 18:30:52 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00083434 |
|---|
| Frequency | 34.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H16N6O2S2 |
|---|
| Molecular Mass | 304.0776 |
|---|
| SMILES | Cc1ncc(CSCCC(N)=NS(N)(=O)=O)c(N)n1 |
|---|
| InChI Key | UKPPUFOBEOQBPZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | diazines |
|---|
| Subclass | pyrimidines and pyrimidine derivatives |
|---|
| Direct Parent | pyrimidines and pyrimidine derivatives |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | amidinesazacyclic compoundsdialkylthioethersheteroaromatic compoundshydrocarbon derivativesimidolactamsorganic oxidesorganic sulfuric acids and derivativesorganopnictogen compoundsprimary aminessulfenyl compounds |
|---|
| Substituents | organic sulfuric acid or derivativessulfenyl compoundaromatic heteromonocyclic compoundazacycledialkylthioetherheteroaromatic compoundamidineorganosulfur compoundpyrimidineorganic oxideorganic oxygen compoundthioetherorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeprimary amineorganic nitrogen compoundimidolactamamine |
|---|
