| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:08:54 UTC |
|---|
| Update Date | 2025-03-21 18:30:54 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00083551 |
|---|
| Frequency | 34.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H6O6S |
|---|
| Molecular Mass | 205.9885 |
|---|
| SMILES | O=S(=O)(O)c1c(O)cc(O)cc1O |
|---|
| InChI Key | JLYIGXJCYFBIJB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzenesulfonic acids and derivatives |
|---|
| Direct Parent | benzenesulfonic acids and derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsarylsulfonic acids and derivativesbenzenesulfonyl compoundshydrocarbon derivativesorganic oxidesorganooxygen compoundsorganosulfonic acidsphloroglucinols and derivativessulfonyls |
|---|
| Substituents | organosulfonic acid or derivativesbenzenetriolorganosulfonic acid1-hydroxy-2-unsubstituted benzenoidbenzenesulfonate1-hydroxy-4-unsubstituted benzenoidorganosulfur compoundphloroglucinol derivativearomatic homomonocyclic compoundorganic oxidesulfonylarylsulfonic acid or derivativesorganic oxygen compoundorganic sulfonic acid or derivativesphenolhydrocarbon derivativeorganooxygen compoundbenzenesulfonyl group |
|---|